C11H6FNO3 — CID 115007780
7-fluoro-3H-[1]benzofuro[2,3-b]pyrrole-2-carboxylic acid (PubChem CID 115007780) has the molecular formula C11H6FNO3 and a molecular weight of 219.17 g/mol. Its IUPAC name is 7-fluoro-3H-[1]benzofuro[2,3-b]pyrrole-2-carboxylic acid.
| Compound Name | 7-fluoro-3H-[1]benzofuro[2,3-b]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 115007780 |
| Molecular Formula | C11H6FNO3 |
| Molecular Weight | 219.17 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | 7-fluoro-3H-[1]benzofuro[2,3-b]pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1cc2c([nH]1)oc1ccc(F)cc12 |
| InChI | InChI=1S/C11H6FNO3/c12-5-1-2-9-6(3-5)7-4-8(11(14)15)13-10(7)16-9/h1-4,13H,(H,14,15) |
| InChIKey | PRCITZBYYKNLSI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.17 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |