C14H19BrN2O — CID 115008005
(8-bromo-5-methyl-2,3,4,4a,10,10a-hexahydro-1H-benzo[b][1,6]naphthyridin-10-yl)methanol (PubChem CID 115008005) has the molecular formula C14H19BrN2O and a molecular weight of 311.22 g/mol. Its IUPAC name is (8-bromo-5-methyl-2,3,4,4a,10,10a-hexahydro-1H-benzo[b][1,6]naphthyridin-10-yl)methanol.
| Compound Name | (8-bromo-5-methyl-2,3,4,4a,10,10a-hexahydro-1H-benzo[b][1,6]naphthyridin-10-yl)methanol |
|---|---|
| PubChem CID | 115008005 |
| Molecular Formula | C14H19BrN2O |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | (8-bromo-5-methyl-2,3,4,4a,10,10a-hexahydro-1H-benzo[b][1,6]naphthyridin-10-yl)methanol |
| SMILES | CN1c2ccc(Br)cc2C(CO)C2CNCCC21 |
| InChI | InChI=1S/C14H19BrN2O/c1-17-13-3-2-9(15)6-10(13)12(8-18)11-7-16-5-4-14(11)17/h2-3,6,11-12,14,16,18H,4-5,7-8H2,1H3 |
| InChIKey | WKMUWLIPSJDMND-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |