C13H15NO2S — CID 115008277
3,4,4a,5,10,10a-hexahydro-1H-thiopyrano[4,3-b]quinoline-10-carboxylic acid (PubChem CID 115008277) has the molecular formula C13H15NO2S and a molecular weight of 249.33 g/mol. Its IUPAC name is 3,4,4a,5,10,10a-hexahydro-1H-thiopyrano[4,3-b]quinoline-10-carboxylic acid.
| Compound Name | 3,4,4a,5,10,10a-hexahydro-1H-thiopyrano[4,3-b]quinoline-10-carboxylic acid |
|---|---|
| PubChem CID | 115008277 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 3,4,4a,5,10,10a-hexahydro-1H-thiopyrano[4,3-b]quinoline-10-carboxylic acid |
| SMILES | O=C(O)C1c2ccccc2NC2CCSCC21 |
| InChI | InChI=1S/C13H15NO2S/c15-13(16)12-8-3-1-2-4-10(8)14-11-5-6-17-7-9(11)12/h1-4,9,11-12,14H,5-7H2,(H,15,16) |
| InChIKey | KEBFHVJUXVVRPY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |