C14H20ClN3 — CID 115008334
6-chloro-2,5-dimethyl-1,3,4,4a,10,10a-hexahydrobenzo[b][1,6]naphthyridin-10-amine (PubChem CID 115008334) has the molecular formula C14H20ClN3 and a molecular weight of 265.79 g/mol. Its IUPAC name is 6-chloro-2,5-dimethyl-1,3,4,4a,10,10a-hexahydrobenzo[b][1,6]naphthyridin-10-amine.
| Compound Name | 6-chloro-2,5-dimethyl-1,3,4,4a,10,10a-hexahydrobenzo[b][1,6]naphthyridin-10-amine |
|---|---|
| PubChem CID | 115008334 |
| Molecular Formula | C14H20ClN3 |
| Molecular Weight | 265.79 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 6-chloro-2,5-dimethyl-1,3,4,4a,10,10a-hexahydrobenzo[b][1,6]naphthyridin-10-amine |
| SMILES | CN1CCC2C(C1)C(N)c1cccc(Cl)c1N2C |
| InChI | InChI=1S/C14H20ClN3/c1-17-7-6-12-10(8-17)13(16)9-4-3-5-11(15)14(9)18(12)2/h3-5,10,12-13H,6-8,16H2,1-2H3 |
| InChIKey | NVSPYAMPLHJMAB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.79 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |