C13H19N3O — CID 115008369
10-amino-5-methyl-2,3,4,4a,10,10a-hexahydro-1H-benzo[b][1,6]naphthyridin-7-ol (PubChem CID 115008369) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is 10-amino-5-methyl-2,3,4,4a,10,10a-hexahydro-1H-benzo[b][1,6]naphthyridin-7-ol.
| Compound Name | 10-amino-5-methyl-2,3,4,4a,10,10a-hexahydro-1H-benzo[b][1,6]naphthyridin-7-ol |
|---|---|
| PubChem CID | 115008369 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 10-amino-5-methyl-2,3,4,4a,10,10a-hexahydro-1H-benzo[b][1,6]naphthyridin-7-ol |
| SMILES | CN1c2cc(O)ccc2C(N)C2CNCCC21 |
| InChI | InChI=1S/C13H19N3O/c1-16-11-4-5-15-7-10(11)13(14)9-3-2-8(17)6-12(9)16/h2-3,6,10-11,13,15,17H,4-5,7,14H2,1H3 |
| InChIKey | UJUURQTZNOKFEY-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |