C13H18N2O2 — CID 115008373
10-amino-5-methyl-1,3,4,4a,10,10a-hexahydropyrano[4,3-b]quinolin-7-ol (PubChem CID 115008373) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 10-amino-5-methyl-1,3,4,4a,10,10a-hexahydropyrano[4,3-b]quinolin-7-ol.
| Compound Name | 10-amino-5-methyl-1,3,4,4a,10,10a-hexahydropyrano[4,3-b]quinolin-7-ol |
|---|---|
| PubChem CID | 115008373 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 10-amino-5-methyl-1,3,4,4a,10,10a-hexahydropyrano[4,3-b]quinolin-7-ol |
| SMILES | CN1c2cc(O)ccc2C(N)C2COCCC21 |
| InChI | InChI=1S/C13H18N2O2/c1-15-11-4-5-17-7-10(11)13(14)9-3-2-8(16)6-12(9)15/h2-3,6,10-11,13,16H,4-5,7,14H2,1H3 |
| InChIKey | LMNSYYDVWDOJTC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |