C12H15FN2S — CID 115008463
8-fluoro-3,4,4a,5,10,10a-hexahydro-1H-thiopyrano[4,3-b]quinolin-10-amine (PubChem CID 115008463) has the molecular formula C12H15FN2S and a molecular weight of 238.33 g/mol. Its IUPAC name is 8-fluoro-3,4,4a,5,10,10a-hexahydro-1H-thiopyrano[4,3-b]quinolin-10-amine.
| Compound Name | 8-fluoro-3,4,4a,5,10,10a-hexahydro-1H-thiopyrano[4,3-b]quinolin-10-amine |
|---|---|
| PubChem CID | 115008463 |
| Molecular Formula | C12H15FN2S |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 8-fluoro-3,4,4a,5,10,10a-hexahydro-1H-thiopyrano[4,3-b]quinolin-10-amine |
| SMILES | NC1c2cc(F)ccc2NC2CCSCC21 |
| InChI | InChI=1S/C12H15FN2S/c13-7-1-2-10-8(5-7)12(14)9-6-16-4-3-11(9)15-10/h1-2,5,9,11-12,15H,3-4,6,14H2 |
| InChIKey | BFCKDEYKKJIAMW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |