C20H28O4 — CID 11500895
(6S)-6-[(1R,2R,3S,5S)-2-[(1E,4Z,6E,8S)-8-hydroxydeca-1,4,6-trienyl]-6-oxabicyclo[3.1.0]hexan-3-yl]oxan-2-one (PubChem CID 11500895) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (6S)-6-[(1R,2R,3S,5S)-2-[(1E,4Z,6E,8S)-8-hydroxydeca-1,4,6-trienyl]-6-oxabicyclo[3.1.0]hexan-3-yl]oxan-2-one.
| Compound Name | (6S)-6-[(1R,2R,3S,5S)-2-[(1E,4Z,6E,8S)-8-hydroxydeca-1,4,6-trienyl]-6-oxabicyclo[3.1.0]hexan-3-yl]oxan-2-one |
|---|---|
| PubChem CID | 11500895 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (6S)-6-[(1R,2R,3S,5S)-2-[(1E,4Z,6E,8S)-8-hydroxydeca-1,4,6-trienyl]-6-oxabicyclo[3.1.0]hexan-3-yl]oxan-2-one |
| SMILES | CC[C@H](O)/C=C/C=C\C/C=C/[C@@H]1[C@@H]([C@@H]2CCCC(=O)O2)C[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C20H28O4/c1-2-14(21)9-6-4-3-5-7-10-15-16(13-18-20(15)24-18)17-11-8-12-19(22)23-17/h3-4,6-7,9-10,14-18,20-21H,2,5,8,11-13H2,1H3/b4-3-,9-6+,10-7+/t14-,15+,16-,17-,18-,20+/m0/s1 |
| InChIKey | YFHYWHWBWQBXAP-CCSRCEOJSA-N |
| XLogP | 3.32 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|