C20H30O4 — CID 11500929
(2S,3R)-6-ethyl-2-[1-[(2R,3R)-6-ethyl-3,5-dimethyl-4-oxo-2,3-dihydropyran-2-yl]ethyl]-3,5-dimethyl-2,3-dihydropyran-4-one (PubChem CID 11500929) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (2S,3R)-6-ethyl-2-[1-[(2R,3R)-6-ethyl-3,5-dimethyl-4-oxo-2,3-dihydropyran-2-yl]ethyl]-3,5-dimethyl-2,3-dihydropyran-4-one.
| Compound Name | (2S,3R)-6-ethyl-2-[1-[(2R,3R)-6-ethyl-3,5-dimethyl-4-oxo-2,3-dihydropyran-2-yl]ethyl]-3,5-dimethyl-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 11500929 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (2S,3R)-6-ethyl-2-[1-[(2R,3R)-6-ethyl-3,5-dimethyl-4-oxo-2,3-dihydropyran-2-yl]ethyl]-3,5-dimethyl-2,3-dihydropyran-4-one |
| SMILES | CCC1=C(C)C(=O)[C@H](C)[C@@H](C(C)[C@@H]2OC(CC)=C(C)C(=O)[C@@H]2C)O1 |
| InChI | InChI=1S/C20H30O4/c1-8-15-10(3)17(21)12(5)19(23-15)14(7)20-13(6)18(22)11(4)16(9-2)24-20/h12-14,19-20H,8-9H2,1-7H3/t12-,13-,14?,19-,20+/m0/s1 |
| InChIKey | XUSGTPVFBNKUFL-QSORGQMYSA-N |
| XLogP | 4.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |