About 6-(hydroxymethyl)-3-(3-hydroxypropyl)-3-azabicyclo[3.1.0]hexane-2,4-dione
6-(hydroxymethyl)-3-(3-hydroxypropyl)-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 115010058) has the molecular formula C9H13NO4
and a molecular weight of 199.21 g/mol. Its IUPAC name is 6-(hydroxymethyl)-3-(3-hydroxypropyl)-3-azabicyclo[3.1.0]hexane-2,4-dione.
Molecular Properties
| Compound Name | 6-(hydroxymethyl)-3-(3-hydroxypropyl)-3-azabicyclo[3.1.0]hexane-2,4-dione |
| PubChem CID | 115010058 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 6-(hydroxymethyl)-3-(3-hydroxypropyl)-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | O=C1C2C(CO)C2C(=O)N1CCCO |
| InChI | InChI=1S/C9H13NO4/c11-3-1-2-10-8(13)6-5(4-12)7(6)9(10)14/h5-7,11-12H,1-4H2 |
| InChIKey | VULYMFJHTFBXIO-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 6-(hydroxymethyl)-3-(3-hydroxypropyl)-3-azabicyclo[3.1.0]hexane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(hydroxymethyl)-3-(3-hydroxypropyl)-3-azabicyclo[3.1.0]hexane-2,4-dione?
The IUPAC name of 6-(hydroxymethyl)-3-(3-hydroxypropyl)-3-azabicyclo[3.1.0]hexane-2,4-dione (CID 115010058) is 6-(hydroxymethyl)-3-(3-hydroxypropyl)-3-azabicyclo[3.1.0]hexane-2,4-dione.
What is the SMILES notation for 6-(hydroxymethyl)-3-(3-hydroxypropyl)-3-azabicyclo[3.1.0]hexane-2,4-dione?
The canonical SMILES for 6-(hydroxymethyl)-3-(3-hydroxypropyl)-3-azabicyclo[3.1.0]hexane-2,4-dione is O=C1C2C(CO)C2C(=O)N1CCCO.
What is the InChIKey of 6-(hydroxymethyl)-3-(3-hydroxypropyl)-3-azabicyclo[3.1.0]hexane-2,4-dione?
The InChIKey is VULYMFJHTFBXIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO4/c11-3-1-2-10-8(13)6-5(4-12)7(6)9(10)14/h5-7,11-12H,1-4H2.
What are the key properties of 6-(hydroxymethyl)-3-(3-hydroxypropyl)-3-azabicyclo[3.1.0]hexane-2,4-dione?
6-(hydroxymethyl)-3-(3-hydroxypropyl)-3-azabicyclo[3.1.0]hexane-2,4-dione has a molecular weight of 199.21 g/mol, XLogP of -1.41, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(hydroxymethyl)-3-(3-hydroxypropyl)-3-azabicyclo[3.1.0]hexane-2,4-dione is sourced from PubChem (CID 115010058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).