About 3-furo[2,3-f][1]benzofuran-4-ylpropanal
3-furo[2,3-f][1]benzofuran-4-ylpropanal (PubChem CID 115010222) has the molecular formula C13H10O3
and a molecular weight of 214.22 g/mol. Its IUPAC name is 3-furo[2,3-f][1]benzofuran-4-ylpropanal.
Molecular Properties
| Compound Name | 3-furo[2,3-f][1]benzofuran-4-ylpropanal |
| PubChem CID | 115010222 |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 3-furo[2,3-f][1]benzofuran-4-ylpropanal |
| SMILES | O=CCCc1c2ccoc2cc2ccoc12 |
| InChI | InChI=1S/C13H10O3/c14-5-1-2-11-10-4-7-15-12(10)8-9-3-6-16-13(9)11/h3-8H,1-2H2 |
| InChIKey | WLGWYGHQOVLFSY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-furo[2,3-f][1]benzofuran-4-ylpropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-furo[2,3-f][1]benzofuran-4-ylpropanal?
The IUPAC name of 3-furo[2,3-f][1]benzofuran-4-ylpropanal (CID 115010222) is 3-furo[2,3-f][1]benzofuran-4-ylpropanal.
What is the SMILES notation for 3-furo[2,3-f][1]benzofuran-4-ylpropanal?
The canonical SMILES for 3-furo[2,3-f][1]benzofuran-4-ylpropanal is O=CCCc1c2ccoc2cc2ccoc12.
What is the InChIKey of 3-furo[2,3-f][1]benzofuran-4-ylpropanal?
The InChIKey is WLGWYGHQOVLFSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O3/c14-5-1-2-11-10-4-7-15-12(10)8-9-3-6-16-13(9)11/h3-8H,1-2H2.
What are the key properties of 3-furo[2,3-f][1]benzofuran-4-ylpropanal?
3-furo[2,3-f][1]benzofuran-4-ylpropanal has a molecular weight of 214.22 g/mol, XLogP of 3.31, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-furo[2,3-f][1]benzofuran-4-ylpropanal is sourced from PubChem (CID 115010222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).