2-furo[2,3-f][1]benzofuran-4-ylacetic acid

C12H8O4 — CID 115010286

IUPAC2-furo[2,3-f][1]benzofuran-4-ylacetic acid
SMILESO=C(O)Cc1c2ccoc2cc2ccoc12
InChIInChI=1S/C12H8O4/c13-11(14)6-9-8-2-4-15-10(8)5-7-1-3-16-12(7)9/h1-5H,6H2,(H,13,14)
InChIKeyDPJVTTRUKZKCQV-UHFFFAOYSA-N
MW216.19 g/mol
LogP2.81
Rot. Bonds2

About 2-furo[2,3-f][1]benzofuran-4-ylacetic acid

2-furo[2,3-f][1]benzofuran-4-ylacetic acid (PubChem CID 115010286) has the molecular formula C12H8O4 and a molecular weight of 216.19 g/mol. Its IUPAC name is 2-furo[2,3-f][1]benzofuran-4-ylacetic acid.

Molecular Properties

Compound Name2-furo[2,3-f][1]benzofuran-4-ylacetic acid
PubChem CID115010286
Molecular FormulaC12H8O4
Molecular Weight216.19 g/mol
Exact Mass216.04
IUPAC Name2-furo[2,3-f][1]benzofuran-4-ylacetic acid
SMILESO=C(O)Cc1c2ccoc2cc2ccoc12
InChIInChI=1S/C12H8O4/c13-11(14)6-9-8-2-4-15-10(8)5-7-1-3-16-12(7)9/h1-5H,6H2,(H,13,14)
InChIKeyDPJVTTRUKZKCQV-UHFFFAOYSA-N
XLogP2.81
TPSA63.58 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.19
LogP ≤ 52.81
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-furo[2,3-f][1]benzofuran-4-ylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-furo[2,3-f][1]benzofuran-4-ylacetic acid?
The IUPAC name of 2-furo[2,3-f][1]benzofuran-4-ylacetic acid (CID 115010286) is 2-furo[2,3-f][1]benzofuran-4-ylacetic acid.
What is the SMILES notation for 2-furo[2,3-f][1]benzofuran-4-ylacetic acid?
The canonical SMILES for 2-furo[2,3-f][1]benzofuran-4-ylacetic acid is O=C(O)Cc1c2ccoc2cc2ccoc12.
What is the InChIKey of 2-furo[2,3-f][1]benzofuran-4-ylacetic acid?
The InChIKey is DPJVTTRUKZKCQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O4/c13-11(14)6-9-8-2-4-15-10(8)5-7-1-3-16-12(7)9/h1-5H,6H2,(H,13,14).
What are the key properties of 2-furo[2,3-f][1]benzofuran-4-ylacetic acid?
2-furo[2,3-f][1]benzofuran-4-ylacetic acid has a molecular weight of 216.19 g/mol, XLogP of 2.81, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-furo[2,3-f][1]benzofuran-4-ylacetic acid is sourced from PubChem (CID 115010286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).