2,6-dimethylfuro[2,3-f][1]benzofuran-4-carboxylic acid

C13H10O4 — CID 115010460

IUPAC2,6-dimethylfuro[2,3-f][1]benzofuran-4-carboxylic acid
SMILESCc1cc2c(C(=O)O)c3oc(C)cc3cc2o1
InChIInChI=1S/C13H10O4/c1-6-3-8-5-10-9(4-7(2)16-10)11(13(14)15)12(8)17-6/h3-5H,1-2H3,(H,14,15)
InChIKeyUBOWKJPDNCVJGR-UHFFFAOYSA-N
MW230.22 g/mol
LogP3.49
Rot. Bonds1

About 2,6-dimethylfuro[2,3-f][1]benzofuran-4-carboxylic acid

2,6-dimethylfuro[2,3-f][1]benzofuran-4-carboxylic acid (PubChem CID 115010460) has the molecular formula C13H10O4 and a molecular weight of 230.22 g/mol. Its IUPAC name is 2,6-dimethylfuro[2,3-f][1]benzofuran-4-carboxylic acid.

Molecular Properties

Compound Name2,6-dimethylfuro[2,3-f][1]benzofuran-4-carboxylic acid
PubChem CID115010460
Molecular FormulaC13H10O4
Molecular Weight230.22 g/mol
Exact Mass230.06
IUPAC Name2,6-dimethylfuro[2,3-f][1]benzofuran-4-carboxylic acid
SMILESCc1cc2c(C(=O)O)c3oc(C)cc3cc2o1
InChIInChI=1S/C13H10O4/c1-6-3-8-5-10-9(4-7(2)16-10)11(13(14)15)12(8)17-6/h3-5H,1-2H3,(H,14,15)
InChIKeyUBOWKJPDNCVJGR-UHFFFAOYSA-N
XLogP3.49
TPSA63.58 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.22
LogP ≤ 53.49
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2,6-dimethylfuro[2,3-f][1]benzofuran-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,6-dimethylfuro[2,3-f][1]benzofuran-4-carboxylic acid?
The IUPAC name of 2,6-dimethylfuro[2,3-f][1]benzofuran-4-carboxylic acid (CID 115010460) is 2,6-dimethylfuro[2,3-f][1]benzofuran-4-carboxylic acid.
What is the SMILES notation for 2,6-dimethylfuro[2,3-f][1]benzofuran-4-carboxylic acid?
The canonical SMILES for 2,6-dimethylfuro[2,3-f][1]benzofuran-4-carboxylic acid is Cc1cc2c(C(=O)O)c3oc(C)cc3cc2o1.
What is the InChIKey of 2,6-dimethylfuro[2,3-f][1]benzofuran-4-carboxylic acid?
The InChIKey is UBOWKJPDNCVJGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O4/c1-6-3-8-5-10-9(4-7(2)16-10)11(13(14)15)12(8)17-6/h3-5H,1-2H3,(H,14,15).
What are the key properties of 2,6-dimethylfuro[2,3-f][1]benzofuran-4-carboxylic acid?
2,6-dimethylfuro[2,3-f][1]benzofuran-4-carboxylic acid has a molecular weight of 230.22 g/mol, XLogP of 3.49, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethylfuro[2,3-f][1]benzofuran-4-carboxylic acid is sourced from PubChem (CID 115010460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).