C21H29NOS — CID 11501072
[1-(4-methylsulfanylbutyl)indol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone (PubChem CID 11501072) has the molecular formula C21H29NOS and a molecular weight of 343.54 g/mol. Its IUPAC name is [1-(4-methylsulfanylbutyl)indol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone.
| Compound Name | [1-(4-methylsulfanylbutyl)indol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone |
|---|---|
| PubChem CID | 11501072 |
| Molecular Formula | C21H29NOS |
| Molecular Weight | 343.54 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | [1-(4-methylsulfanylbutyl)indol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone |
| SMILES | CSCCCCn1cc(C(=O)C2C(C)(C)C2(C)C)c2ccccc21 |
| InChI | InChI=1S/C21H29NOS/c1-20(2)19(21(20,3)4)18(23)16-14-22(12-8-9-13-24-5)17-11-7-6-10-15(16)17/h6-7,10-11,14,19H,8-9,12-13H2,1-5H3 |
| InChIKey | NIMZZWGHIZCSPU-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.54 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|