C13H18O — CID 115010757
1,1,7-trimethyl-3,4-dihydro-2H-naphthalen-2-ol (PubChem CID 115010757) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is 1,1,7-trimethyl-3,4-dihydro-2H-naphthalen-2-ol.
| Compound Name | 1,1,7-trimethyl-3,4-dihydro-2H-naphthalen-2-ol |
|---|---|
| PubChem CID | 115010757 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 1,1,7-trimethyl-3,4-dihydro-2H-naphthalen-2-ol |
| SMILES | Cc1ccc2c(c1)C(C)(C)C(O)CC2 |
| InChI | InChI=1S/C13H18O/c1-9-4-5-10-6-7-12(14)13(2,3)11(10)8-9/h4-5,8,12,14H,6-7H2,1-3H3 |
| InChIKey | APNTWNNOIJPNST-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |