About 4-methoxy-3,3-dimethylpyrrolidine
4-methoxy-3,3-dimethylpyrrolidine (PubChem CID 115011214) has the molecular formula C7H15NO
and a molecular weight of 129.20 g/mol. Its IUPAC name is 4-methoxy-3,3-dimethylpyrrolidine.
Molecular Properties
| Compound Name | 4-methoxy-3,3-dimethylpyrrolidine |
| PubChem CID | 115011214 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | 4-methoxy-3,3-dimethylpyrrolidine |
| SMILES | COC1CNCC1(C)C |
| InChI | InChI=1S/C7H15NO/c1-7(2)5-8-4-6(7)9-3/h6,8H,4-5H2,1-3H3 |
| InChIKey | ULABXABPWDXDFQ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methoxy-3,3-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-3,3-dimethylpyrrolidine?
The IUPAC name of 4-methoxy-3,3-dimethylpyrrolidine (CID 115011214) is 4-methoxy-3,3-dimethylpyrrolidine.
What is the SMILES notation for 4-methoxy-3,3-dimethylpyrrolidine?
The canonical SMILES for 4-methoxy-3,3-dimethylpyrrolidine is COC1CNCC1(C)C.
What is the InChIKey of 4-methoxy-3,3-dimethylpyrrolidine?
The InChIKey is ULABXABPWDXDFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO/c1-7(2)5-8-4-6(7)9-3/h6,8H,4-5H2,1-3H3.
What are the key properties of 4-methoxy-3,3-dimethylpyrrolidine?
4-methoxy-3,3-dimethylpyrrolidine has a molecular weight of 129.20 g/mol, XLogP of 0.63, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-3,3-dimethylpyrrolidine is sourced from PubChem (CID 115011214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).