About 5-cyclopentyl-1,3-oxazol-2-amine
5-cyclopentyl-1,3-oxazol-2-amine (PubChem CID 115011861) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 5-cyclopentyl-1,3-oxazol-2-amine.
Molecular Properties
| Compound Name | 5-cyclopentyl-1,3-oxazol-2-amine |
| PubChem CID | 115011861 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 5-cyclopentyl-1,3-oxazol-2-amine |
| SMILES | Nc1ncc(C2CCCC2)o1 |
| InChI | InChI=1S/C8H12N2O/c9-8-10-5-7(11-8)6-3-1-2-4-6/h5-6H,1-4H2,(H2,9,10) |
| InChIKey | CHQDDFSVHQIZTD-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-cyclopentyl-1,3-oxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopentyl-1,3-oxazol-2-amine?
The IUPAC name of 5-cyclopentyl-1,3-oxazol-2-amine (CID 115011861) is 5-cyclopentyl-1,3-oxazol-2-amine.
What is the SMILES notation for 5-cyclopentyl-1,3-oxazol-2-amine?
The canonical SMILES for 5-cyclopentyl-1,3-oxazol-2-amine is Nc1ncc(C2CCCC2)o1.
What is the InChIKey of 5-cyclopentyl-1,3-oxazol-2-amine?
The InChIKey is CHQDDFSVHQIZTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c9-8-10-5-7(11-8)6-3-1-2-4-6/h5-6H,1-4H2,(H2,9,10).
What are the key properties of 5-cyclopentyl-1,3-oxazol-2-amine?
5-cyclopentyl-1,3-oxazol-2-amine has a molecular weight of 152.20 g/mol, XLogP of 1.91, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopentyl-1,3-oxazol-2-amine is sourced from PubChem (CID 115011861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).