C13H12Cl3NO4 — CID 11501237
(2R,3S,4R,5S)-2-(hydroxymethyl)-5-(2,5,6-trichloro-1H-indol-3-yl)oxolane-3,4-diol (PubChem CID 11501237) has the molecular formula C13H12Cl3NO4 and a molecular weight of 352.60 g/mol. Its IUPAC name is (2R,3S,4R,5S)-2-(hydroxymethyl)-5-(2,5,6-trichloro-1H-indol-3-yl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5S)-2-(hydroxymethyl)-5-(2,5,6-trichloro-1H-indol-3-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 11501237 |
| Molecular Formula | C13H12Cl3NO4 |
| Molecular Weight | 352.60 g/mol |
| Exact Mass | 350.98 |
| IUPAC Name | (2R,3S,4R,5S)-2-(hydroxymethyl)-5-(2,5,6-trichloro-1H-indol-3-yl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](c2c(Cl)[nH]c3cc(Cl)c(Cl)cc23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H12Cl3NO4/c14-5-1-4-7(2-6(5)15)17-13(16)9(4)12-11(20)10(19)8(3-18)21-12/h1-2,8,10-12,17-20H,3H2/t8-,10-,11-,12+/m1/s1 |
| InChIKey | CIVPFLSXCJEUKP-HKWIRBFKSA-N |
| XLogP | 2.28 |
| TPSA | 85.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.60 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |