About 7-methylspiro[1,2-dihydroisoindole-3,1'-cyclopropane]
7-methylspiro[1,2-dihydroisoindole-3,1'-cyclopropane] (PubChem CID 115012488) has the molecular formula C11H13N
and a molecular weight of 159.23 g/mol. Its IUPAC name is 7-methylspiro[1,2-dihydroisoindole-3,1'-cyclopropane].
Molecular Properties
| Compound Name | 7-methylspiro[1,2-dihydroisoindole-3,1'-cyclopropane] |
| PubChem CID | 115012488 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 7-methylspiro[1,2-dihydroisoindole-3,1'-cyclopropane] |
| SMILES | Cc1cccc2c1CNC21CC1 |
| InChI | InChI=1S/C11H13N/c1-8-3-2-4-10-9(8)7-12-11(10)5-6-11/h2-4,12H,5-7H2,1H3 |
| InChIKey | ZMKCRVZXZODDGS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-methylspiro[1,2-dihydroisoindole-3,1'-cyclopropane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylspiro[1,2-dihydroisoindole-3,1'-cyclopropane]?
The IUPAC name of 7-methylspiro[1,2-dihydroisoindole-3,1'-cyclopropane] (CID 115012488) is 7-methylspiro[1,2-dihydroisoindole-3,1'-cyclopropane].
What is the SMILES notation for 7-methylspiro[1,2-dihydroisoindole-3,1'-cyclopropane]?
The canonical SMILES for 7-methylspiro[1,2-dihydroisoindole-3,1'-cyclopropane] is Cc1cccc2c1CNC21CC1.
What is the InChIKey of 7-methylspiro[1,2-dihydroisoindole-3,1'-cyclopropane]?
The InChIKey is ZMKCRVZXZODDGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N/c1-8-3-2-4-10-9(8)7-12-11(10)5-6-11/h2-4,12H,5-7H2,1H3.
What are the key properties of 7-methylspiro[1,2-dihydroisoindole-3,1'-cyclopropane]?
7-methylspiro[1,2-dihydroisoindole-3,1'-cyclopropane] has a molecular weight of 159.23 g/mol, XLogP of 2.09, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylspiro[1,2-dihydroisoindole-3,1'-cyclopropane] is sourced from PubChem (CID 115012488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).