About 3-ethyl-7H-furo[3,4-b]pyridin-5-one
3-ethyl-7H-furo[3,4-b]pyridin-5-one (PubChem CID 115012810) has the molecular formula C9H9NO2
and a molecular weight of 163.18 g/mol. Its IUPAC name is 3-ethyl-7H-furo[3,4-b]pyridin-5-one.
Molecular Properties
| Compound Name | 3-ethyl-7H-furo[3,4-b]pyridin-5-one |
| PubChem CID | 115012810 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 3-ethyl-7H-furo[3,4-b]pyridin-5-one |
| SMILES | CCc1cnc2c(c1)C(=O)OC2 |
| InChI | InChI=1S/C9H9NO2/c1-2-6-3-7-8(10-4-6)5-12-9(7)11/h3-4H,2,5H2,1H3 |
| InChIKey | WSJNLKBTFGBSGL-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethyl-7H-furo[3,4-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-7H-furo[3,4-b]pyridin-5-one?
The IUPAC name of 3-ethyl-7H-furo[3,4-b]pyridin-5-one (CID 115012810) is 3-ethyl-7H-furo[3,4-b]pyridin-5-one.
What is the SMILES notation for 3-ethyl-7H-furo[3,4-b]pyridin-5-one?
The canonical SMILES for 3-ethyl-7H-furo[3,4-b]pyridin-5-one is CCc1cnc2c(c1)C(=O)OC2.
What is the InChIKey of 3-ethyl-7H-furo[3,4-b]pyridin-5-one?
The InChIKey is WSJNLKBTFGBSGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2/c1-2-6-3-7-8(10-4-6)5-12-9(7)11/h3-4H,2,5H2,1H3.
What are the key properties of 3-ethyl-7H-furo[3,4-b]pyridin-5-one?
3-ethyl-7H-furo[3,4-b]pyridin-5-one has a molecular weight of 163.18 g/mol, XLogP of 1.31, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-7H-furo[3,4-b]pyridin-5-one is sourced from PubChem (CID 115012810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).