About 3,4-bis(2-hydroxyethylsulfanyl)-1-(3-methoxyphenyl)pyrrole-2,5-dione
3,4-bis(2-hydroxyethylsulfanyl)-1-(3-methoxyphenyl)pyrrole-2,5-dione (PubChem CID 11501285) has the molecular formula C15H17NO5S2
and a molecular weight of 355.44 g/mol. Its IUPAC name is 3,4-bis(2-hydroxyethylsulfanyl)-1-(3-methoxyphenyl)pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 3,4-bis(2-hydroxyethylsulfanyl)-1-(3-methoxyphenyl)pyrrole-2,5-dione |
| PubChem CID | 11501285 |
| Molecular Formula | C15H17NO5S2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 3,4-bis(2-hydroxyethylsulfanyl)-1-(3-methoxyphenyl)pyrrole-2,5-dione |
| SMILES | COc1cccc(N2C(=O)C(SCCO)=C(SCCO)C2=O)c1 |
| InChI | InChI=1S/C15H17NO5S2/c1-21-11-4-2-3-10(9-11)16-14(19)12(22-7-5-17)13(15(16)20)23-8-6-18/h2-4,9,17-18H,5-8H2,1H3 |
| InChIKey | FRDLKFZCBAJHPZ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3,4-bis(2-hydroxyethylsulfanyl)-1-(3-methoxyphenyl)pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(2-hydroxyethylsulfanyl)-1-(3-methoxyphenyl)pyrrole-2,5-dione?
The IUPAC name of 3,4-bis(2-hydroxyethylsulfanyl)-1-(3-methoxyphenyl)pyrrole-2,5-dione (CID 11501285) is 3,4-bis(2-hydroxyethylsulfanyl)-1-(3-methoxyphenyl)pyrrole-2,5-dione.
What is the SMILES notation for 3,4-bis(2-hydroxyethylsulfanyl)-1-(3-methoxyphenyl)pyrrole-2,5-dione?
The canonical SMILES for 3,4-bis(2-hydroxyethylsulfanyl)-1-(3-methoxyphenyl)pyrrole-2,5-dione is COc1cccc(N2C(=O)C(SCCO)=C(SCCO)C2=O)c1.
What is the InChIKey of 3,4-bis(2-hydroxyethylsulfanyl)-1-(3-methoxyphenyl)pyrrole-2,5-dione?
The InChIKey is FRDLKFZCBAJHPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO5S2/c1-21-11-4-2-3-10(9-11)16-14(19)12(22-7-5-17)13(15(16)20)23-8-6-18/h2-4,9,17-18H,5-8H2,1H3.
What are the key properties of 3,4-bis(2-hydroxyethylsulfanyl)-1-(3-methoxyphenyl)pyrrole-2,5-dione?
3,4-bis(2-hydroxyethylsulfanyl)-1-(3-methoxyphenyl)pyrrole-2,5-dione has a molecular weight of 355.44 g/mol, XLogP of 1.23, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(2-hydroxyethylsulfanyl)-1-(3-methoxyphenyl)pyrrole-2,5-dione is sourced from PubChem (CID 11501285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).