oxan-4-ylmethanesulfinic acid

C6H12O3S — CID 115012984

IUPACoxan-4-ylmethanesulfinic acid
SMILESO=S(O)CC1CCOCC1
InChIInChI=1S/C6H12O3S/c7-10(8)5-6-1-3-9-4-2-6/h6H,1-5H2,(H,7,8)
InChIKeyDZZTWMJIFHUBHR-UHFFFAOYSA-N
MW164.23 g/mol
LogP0.63
Rot. Bonds2

About oxan-4-ylmethanesulfinic acid

oxan-4-ylmethanesulfinic acid (PubChem CID 115012984) has the molecular formula C6H12O3S and a molecular weight of 164.23 g/mol. Its IUPAC name is oxan-4-ylmethanesulfinic acid.

Molecular Properties

Compound Nameoxan-4-ylmethanesulfinic acid
PubChem CID115012984
Molecular FormulaC6H12O3S
Molecular Weight164.23 g/mol
Exact Mass164.05
IUPAC Nameoxan-4-ylmethanesulfinic acid
SMILESO=S(O)CC1CCOCC1
InChIInChI=1S/C6H12O3S/c7-10(8)5-6-1-3-9-4-2-6/h6H,1-5H2,(H,7,8)
InChIKeyDZZTWMJIFHUBHR-UHFFFAOYSA-N
XLogP0.63
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500164.23
LogP ≤ 50.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze oxan-4-ylmethanesulfinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of oxan-4-ylmethanesulfinic acid?
The IUPAC name of oxan-4-ylmethanesulfinic acid (CID 115012984) is oxan-4-ylmethanesulfinic acid.
What is the SMILES notation for oxan-4-ylmethanesulfinic acid?
The canonical SMILES for oxan-4-ylmethanesulfinic acid is O=S(O)CC1CCOCC1.
What is the InChIKey of oxan-4-ylmethanesulfinic acid?
The InChIKey is DZZTWMJIFHUBHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3S/c7-10(8)5-6-1-3-9-4-2-6/h6H,1-5H2,(H,7,8).
What are the key properties of oxan-4-ylmethanesulfinic acid?
oxan-4-ylmethanesulfinic acid has a molecular weight of 164.23 g/mol, XLogP of 0.63, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-4-ylmethanesulfinic acid is sourced from PubChem (CID 115012984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).