About oxan-4-ylmethanesulfinic acid
oxan-4-ylmethanesulfinic acid (PubChem CID 115012984) has the molecular formula C6H12O3S
and a molecular weight of 164.23 g/mol. Its IUPAC name is oxan-4-ylmethanesulfinic acid.
Molecular Properties
| Compound Name | oxan-4-ylmethanesulfinic acid |
| PubChem CID | 115012984 |
| Molecular Formula | C6H12O3S |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | oxan-4-ylmethanesulfinic acid |
| SMILES | O=S(O)CC1CCOCC1 |
| InChI | InChI=1S/C6H12O3S/c7-10(8)5-6-1-3-9-4-2-6/h6H,1-5H2,(H,7,8) |
| InChIKey | DZZTWMJIFHUBHR-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze oxan-4-ylmethanesulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-4-ylmethanesulfinic acid?
The IUPAC name of oxan-4-ylmethanesulfinic acid (CID 115012984) is oxan-4-ylmethanesulfinic acid.
What is the SMILES notation for oxan-4-ylmethanesulfinic acid?
The canonical SMILES for oxan-4-ylmethanesulfinic acid is O=S(O)CC1CCOCC1.
What is the InChIKey of oxan-4-ylmethanesulfinic acid?
The InChIKey is DZZTWMJIFHUBHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3S/c7-10(8)5-6-1-3-9-4-2-6/h6H,1-5H2,(H,7,8).
What are the key properties of oxan-4-ylmethanesulfinic acid?
oxan-4-ylmethanesulfinic acid has a molecular weight of 164.23 g/mol, XLogP of 0.63, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-4-ylmethanesulfinic acid is sourced from PubChem (CID 115012984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).