About 3,3-dimethylpiperidin-4-ol;hydrochloride
3,3-dimethylpiperidin-4-ol;hydrochloride (PubChem CID 115013107) has the molecular formula C7H16ClNO
and a molecular weight of 165.66 g/mol. Its IUPAC name is 3,3-dimethylpiperidin-4-ol;hydrochloride.
Molecular Properties
| Compound Name | 3,3-dimethylpiperidin-4-ol;hydrochloride |
| PubChem CID | 115013107 |
| Molecular Formula | C7H16ClNO |
| Molecular Weight | 165.66 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 3,3-dimethylpiperidin-4-ol;hydrochloride |
| SMILES | CC1(C)CNCCC1O.Cl |
| InChI | InChI=1S/C7H15NO.ClH/c1-7(2)5-8-4-3-6(7)9;/h6,8-9H,3-5H2,1-2H3;1H |
| InChIKey | FQRAXUZEOIRMLF-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.66 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-dimethylpiperidin-4-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethylpiperidin-4-ol;hydrochloride?
The IUPAC name of 3,3-dimethylpiperidin-4-ol;hydrochloride (CID 115013107) is 3,3-dimethylpiperidin-4-ol;hydrochloride.
What is the SMILES notation for 3,3-dimethylpiperidin-4-ol;hydrochloride?
The canonical SMILES for 3,3-dimethylpiperidin-4-ol;hydrochloride is CC1(C)CNCCC1O.Cl.
What is the InChIKey of 3,3-dimethylpiperidin-4-ol;hydrochloride?
The InChIKey is FQRAXUZEOIRMLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO.ClH/c1-7(2)5-8-4-3-6(7)9;/h6,8-9H,3-5H2,1-2H3;1H.
What are the key properties of 3,3-dimethylpiperidin-4-ol;hydrochloride?
3,3-dimethylpiperidin-4-ol;hydrochloride has a molecular weight of 165.66 g/mol, XLogP of 0.79, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylpiperidin-4-ol;hydrochloride is sourced from PubChem (CID 115013107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).