About 5-(2-methyloxolan-2-yl)-1,3-oxazol-2-amine
5-(2-methyloxolan-2-yl)-1,3-oxazol-2-amine (PubChem CID 115013415) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is 5-(2-methyloxolan-2-yl)-1,3-oxazol-2-amine.
Molecular Properties
| Compound Name | 5-(2-methyloxolan-2-yl)-1,3-oxazol-2-amine |
| PubChem CID | 115013415 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 5-(2-methyloxolan-2-yl)-1,3-oxazol-2-amine |
| SMILES | CC1(c2cnc(N)o2)CCCO1 |
| InChI | InChI=1S/C8H12N2O2/c1-8(3-2-4-11-8)6-5-10-7(9)12-6/h5H,2-4H2,1H3,(H2,9,10) |
| InChIKey | JLUHJBLOIOGWEA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2-methyloxolan-2-yl)-1,3-oxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methyloxolan-2-yl)-1,3-oxazol-2-amine?
The IUPAC name of 5-(2-methyloxolan-2-yl)-1,3-oxazol-2-amine (CID 115013415) is 5-(2-methyloxolan-2-yl)-1,3-oxazol-2-amine.
What is the SMILES notation for 5-(2-methyloxolan-2-yl)-1,3-oxazol-2-amine?
The canonical SMILES for 5-(2-methyloxolan-2-yl)-1,3-oxazol-2-amine is CC1(c2cnc(N)o2)CCCO1.
What is the InChIKey of 5-(2-methyloxolan-2-yl)-1,3-oxazol-2-amine?
The InChIKey is JLUHJBLOIOGWEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-8(3-2-4-11-8)6-5-10-7(9)12-6/h5H,2-4H2,1H3,(H2,9,10).
What are the key properties of 5-(2-methyloxolan-2-yl)-1,3-oxazol-2-amine?
5-(2-methyloxolan-2-yl)-1,3-oxazol-2-amine has a molecular weight of 168.20 g/mol, XLogP of 1.28, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methyloxolan-2-yl)-1,3-oxazol-2-amine is sourced from PubChem (CID 115013415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).