C18H11F3N2O3 — CID 11501372
3-[4-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]benzoic acid (PubChem CID 11501372) has the molecular formula C18H11F3N2O3 and a molecular weight of 360.29 g/mol. Its IUPAC name is 3-[4-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]benzoic acid.
| Compound Name | 3-[4-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 11501372 |
| Molecular Formula | C18H11F3N2O3 |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 3-[4-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2nccc(-c3ccc(OC(F)(F)F)cc3)n2)c1 |
| InChI | InChI=1S/C18H11F3N2O3/c19-18(20,21)26-14-6-4-11(5-7-14)15-8-9-22-16(23-15)12-2-1-3-13(10-12)17(24)25/h1-10H,(H,24,25) |
| InChIKey | IRDZUAQSZGNXDU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |