C22H34O4 — CID 11501422
(1S,3S,4E,4aS,7E,9R,11aR)-1,3-dimethoxy-7-methyl-11-methylidene-4-[(E)-4-methylpent-2-enylidene]-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-9-ol (PubChem CID 11501422) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is (1S,3S,4E,4aS,7E,9R,11aR)-1,3-dimethoxy-7-methyl-11-methylidene-4-[(E)-4-methylpent-2-enylidene]-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-9-ol.
| Compound Name | (1S,3S,4E,4aS,7E,9R,11aR)-1,3-dimethoxy-7-methyl-11-methylidene-4-[(E)-4-methylpent-2-enylidene]-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-9-ol |
|---|---|
| PubChem CID | 11501422 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | (1S,3S,4E,4aS,7E,9R,11aR)-1,3-dimethoxy-7-methyl-11-methylidene-4-[(E)-4-methylpent-2-enylidene]-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-9-ol |
| SMILES | C=C1C[C@@H](O)/C=C(\C)CC[C@@H]2/C(=C\C=C\C(C)C)[C@@H](OC)O[C@H](OC)[C@@H]12 |
| InChI | InChI=1S/C22H34O4/c1-14(2)8-7-9-19-18-11-10-15(3)12-17(23)13-16(4)20(18)22(25-6)26-21(19)24-5/h7-9,12,14,17-18,20-23H,4,10-11,13H2,1-3,5-6H3/b8-7+,15-12+,19-9+/t17-,18+,20-,21-,22-/m0/s1 |
| InChIKey | LKDFPVGNFJBDEC-GYBNHQDSSA-N |
| XLogP | 4.38 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|