About 2-amino-1H-pyrido[1,2-a]pyrimidine-4,8-dione
2-amino-1H-pyrido[1,2-a]pyrimidine-4,8-dione (PubChem CID 115014799) has the molecular formula C8H7N3O2
and a molecular weight of 177.16 g/mol. Its IUPAC name is 2-amino-1H-pyrido[1,2-a]pyrimidine-4,8-dione.
Molecular Properties
| Compound Name | 2-amino-1H-pyrido[1,2-a]pyrimidine-4,8-dione |
| PubChem CID | 115014799 |
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | 2-amino-1H-pyrido[1,2-a]pyrimidine-4,8-dione |
| SMILES | Nc1cc(=O)n2ccc(=O)cc2[nH]1 |
| InChI | InChI=1S/C8H7N3O2/c9-6-4-8(13)11-2-1-5(12)3-7(11)10-6/h1-4,10H,9H2 |
| InChIKey | BGCGBOHSMYCOMH-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 80.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-1H-pyrido[1,2-a]pyrimidine-4,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1H-pyrido[1,2-a]pyrimidine-4,8-dione?
The IUPAC name of 2-amino-1H-pyrido[1,2-a]pyrimidine-4,8-dione (CID 115014799) is 2-amino-1H-pyrido[1,2-a]pyrimidine-4,8-dione.
What is the SMILES notation for 2-amino-1H-pyrido[1,2-a]pyrimidine-4,8-dione?
The canonical SMILES for 2-amino-1H-pyrido[1,2-a]pyrimidine-4,8-dione is Nc1cc(=O)n2ccc(=O)cc2[nH]1.
What is the InChIKey of 2-amino-1H-pyrido[1,2-a]pyrimidine-4,8-dione?
The InChIKey is BGCGBOHSMYCOMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O2/c9-6-4-8(13)11-2-1-5(12)3-7(11)10-6/h1-4,10H,9H2.
What are the key properties of 2-amino-1H-pyrido[1,2-a]pyrimidine-4,8-dione?
2-amino-1H-pyrido[1,2-a]pyrimidine-4,8-dione has a molecular weight of 177.16 g/mol, XLogP of -0.43, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1H-pyrido[1,2-a]pyrimidine-4,8-dione is sourced from PubChem (CID 115014799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).