About 1-[6-(2,2-dimethylpropoxy)naphthalen-2-yl]-1-imidazol-1-yl-N,N-dimethylpropan-2-amine
1-[6-(2,2-dimethylpropoxy)naphthalen-2-yl]-1-imidazol-1-yl-N,N-dimethylpropan-2-amine (PubChem CID 11501485) has the molecular formula C23H31N3O
and a molecular weight of 365.52 g/mol. Its IUPAC name is 1-[6-(2,2-dimethylpropoxy)naphthalen-2-yl]-1-imidazol-1-yl-N,N-dimethylpropan-2-amine.
Molecular Properties
| Compound Name | 1-[6-(2,2-dimethylpropoxy)naphthalen-2-yl]-1-imidazol-1-yl-N,N-dimethylpropan-2-amine |
| PubChem CID | 11501485 |
| Molecular Formula | C23H31N3O |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | 1-[6-(2,2-dimethylpropoxy)naphthalen-2-yl]-1-imidazol-1-yl-N,N-dimethylpropan-2-amine |
| SMILES | CC(C(c1ccc2cc(OCC(C)(C)C)ccc2c1)n1ccnc1)N(C)C |
| InChI | InChI=1S/C23H31N3O/c1-17(25(5)6)22(26-12-11-24-16-26)20-8-7-19-14-21(10-9-18(19)13-20)27-15-23(2,3)4/h7-14,16-17,22H,15H2,1-6H3 |
| InChIKey | ZZGVWUSRXVYCSC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[6-(2,2-dimethylpropoxy)naphthalen-2-yl]-1-imidazol-1-yl-N,N-dimethylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(2,2-dimethylpropoxy)naphthalen-2-yl]-1-imidazol-1-yl-N,N-dimethylpropan-2-amine?
The IUPAC name of 1-[6-(2,2-dimethylpropoxy)naphthalen-2-yl]-1-imidazol-1-yl-N,N-dimethylpropan-2-amine (CID 11501485) is 1-[6-(2,2-dimethylpropoxy)naphthalen-2-yl]-1-imidazol-1-yl-N,N-dimethylpropan-2-amine.
What is the SMILES notation for 1-[6-(2,2-dimethylpropoxy)naphthalen-2-yl]-1-imidazol-1-yl-N,N-dimethylpropan-2-amine?
The canonical SMILES for 1-[6-(2,2-dimethylpropoxy)naphthalen-2-yl]-1-imidazol-1-yl-N,N-dimethylpropan-2-amine is CC(C(c1ccc2cc(OCC(C)(C)C)ccc2c1)n1ccnc1)N(C)C.
What is the InChIKey of 1-[6-(2,2-dimethylpropoxy)naphthalen-2-yl]-1-imidazol-1-yl-N,N-dimethylpropan-2-amine?
The InChIKey is ZZGVWUSRXVYCSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H31N3O/c1-17(25(5)6)22(26-12-11-24-16-26)20-8-7-19-14-21(10-9-18(19)13-20)27-15-23(2,3)4/h7-14,16-17,22H,15H2,1-6H3.
What are the key properties of 1-[6-(2,2-dimethylpropoxy)naphthalen-2-yl]-1-imidazol-1-yl-N,N-dimethylpropan-2-amine?
1-[6-(2,2-dimethylpropoxy)naphthalen-2-yl]-1-imidazol-1-yl-N,N-dimethylpropan-2-amine has a molecular weight of 365.52 g/mol, XLogP of 5.00, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(2,2-dimethylpropoxy)naphthalen-2-yl]-1-imidazol-1-yl-N,N-dimethylpropan-2-amine is sourced from PubChem (CID 11501485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).