About 1-(2-fluorophenyl)-1,2,4-triazol-3-amine
1-(2-fluorophenyl)-1,2,4-triazol-3-amine (PubChem CID 115015063) has the molecular formula C8H7FN4
and a molecular weight of 178.17 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 1-(2-fluorophenyl)-1,2,4-triazol-3-amine |
| PubChem CID | 115015063 |
| Molecular Formula | C8H7FN4 |
| Molecular Weight | 178.17 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 1-(2-fluorophenyl)-1,2,4-triazol-3-amine |
| SMILES | Nc1ncn(-c2ccccc2F)n1 |
| InChI | InChI=1S/C8H7FN4/c9-6-3-1-2-4-7(6)13-5-11-8(10)12-13/h1-5H,(H2,10,12) |
| InChIKey | UVUQKWAIBHQJPT-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.17 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-fluorophenyl)-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-fluorophenyl)-1,2,4-triazol-3-amine?
The IUPAC name of 1-(2-fluorophenyl)-1,2,4-triazol-3-amine (CID 115015063) is 1-(2-fluorophenyl)-1,2,4-triazol-3-amine.
What is the SMILES notation for 1-(2-fluorophenyl)-1,2,4-triazol-3-amine?
The canonical SMILES for 1-(2-fluorophenyl)-1,2,4-triazol-3-amine is Nc1ncn(-c2ccccc2F)n1.
What is the InChIKey of 1-(2-fluorophenyl)-1,2,4-triazol-3-amine?
The InChIKey is UVUQKWAIBHQJPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7FN4/c9-6-3-1-2-4-7(6)13-5-11-8(10)12-13/h1-5H,(H2,10,12).
What are the key properties of 1-(2-fluorophenyl)-1,2,4-triazol-3-amine?
1-(2-fluorophenyl)-1,2,4-triazol-3-amine has a molecular weight of 178.17 g/mol, XLogP of 0.99, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-fluorophenyl)-1,2,4-triazol-3-amine is sourced from PubChem (CID 115015063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).