About 3-amino-9-fluoropyrido[1,2-a]pyrimidin-4-one
3-amino-9-fluoropyrido[1,2-a]pyrimidin-4-one (PubChem CID 115015296) has the molecular formula C8H6FN3O
and a molecular weight of 179.15 g/mol. Its IUPAC name is 3-amino-9-fluoropyrido[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-amino-9-fluoropyrido[1,2-a]pyrimidin-4-one |
| PubChem CID | 115015296 |
| Molecular Formula | C8H6FN3O |
| Molecular Weight | 179.15 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 3-amino-9-fluoropyrido[1,2-a]pyrimidin-4-one |
| SMILES | Nc1cnc2c(F)cccn2c1=O |
| InChI | InChI=1S/C8H6FN3O/c9-5-2-1-3-12-7(5)11-4-6(10)8(12)13/h1-4H,10H2 |
| InChIKey | BWEAZLSNYQSUDN-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.15 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-9-fluoropyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-9-fluoropyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of 3-amino-9-fluoropyrido[1,2-a]pyrimidin-4-one (CID 115015296) is 3-amino-9-fluoropyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 3-amino-9-fluoropyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 3-amino-9-fluoropyrido[1,2-a]pyrimidin-4-one is Nc1cnc2c(F)cccn2c1=O.
What is the InChIKey of 3-amino-9-fluoropyrido[1,2-a]pyrimidin-4-one?
The InChIKey is BWEAZLSNYQSUDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6FN3O/c9-5-2-1-3-12-7(5)11-4-6(10)8(12)13/h1-4H,10H2.
What are the key properties of 3-amino-9-fluoropyrido[1,2-a]pyrimidin-4-one?
3-amino-9-fluoropyrido[1,2-a]pyrimidin-4-one has a molecular weight of 179.15 g/mol, XLogP of 0.42, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-9-fluoropyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 115015296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).