C20H24N4O3 — CID 11501535
1-[(1R,2R,4S)-2-hydroxy-4-(hydroxymethyl)cyclopentyl]-5-[2-(4-propylphenyl)ethynyl]triazole-4-carboxamide (PubChem CID 11501535) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is 1-[(1R,2R,4S)-2-hydroxy-4-(hydroxymethyl)cyclopentyl]-5-[2-(4-propylphenyl)ethynyl]triazole-4-carboxamide.
| Compound Name | 1-[(1R,2R,4S)-2-hydroxy-4-(hydroxymethyl)cyclopentyl]-5-[2-(4-propylphenyl)ethynyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 11501535 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 1-[(1R,2R,4S)-2-hydroxy-4-(hydroxymethyl)cyclopentyl]-5-[2-(4-propylphenyl)ethynyl]triazole-4-carboxamide |
| SMILES | CCCc1ccc(C#Cc2c(C(N)=O)nnn2[C@@H]2C[C@H](CO)C[C@H]2O)cc1 |
| InChI | InChI=1S/C20H24N4O3/c1-2-3-13-4-6-14(7-5-13)8-9-16-19(20(21)27)22-23-24(16)17-10-15(12-25)11-18(17)26/h4-7,15,17-18,25-26H,2-3,10-12H2,1H3,(H2,21,27)/t15-,17+,18+/m0/s1 |
| InChIKey | CAJNYVSQGIAEPN-CGTJXYLNSA-N |
| XLogP | 1.03 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|