About 4-methoxy-3,3-dimethylpiperidine;hydrochloride
4-methoxy-3,3-dimethylpiperidine;hydrochloride (PubChem CID 115015546) has the molecular formula C8H18ClNO
and a molecular weight of 179.69 g/mol. Its IUPAC name is 4-methoxy-3,3-dimethylpiperidine;hydrochloride.
Molecular Properties
| Compound Name | 4-methoxy-3,3-dimethylpiperidine;hydrochloride |
| PubChem CID | 115015546 |
| Molecular Formula | C8H18ClNO |
| Molecular Weight | 179.69 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 4-methoxy-3,3-dimethylpiperidine;hydrochloride |
| SMILES | COC1CCNCC1(C)C.Cl |
| InChI | InChI=1S/C8H17NO.ClH/c1-8(2)6-9-5-4-7(8)10-3;/h7,9H,4-6H2,1-3H3;1H |
| InChIKey | JKLCZYXBGWNKMV-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.69 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methoxy-3,3-dimethylpiperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-3,3-dimethylpiperidine;hydrochloride?
The IUPAC name of 4-methoxy-3,3-dimethylpiperidine;hydrochloride (CID 115015546) is 4-methoxy-3,3-dimethylpiperidine;hydrochloride.
What is the SMILES notation for 4-methoxy-3,3-dimethylpiperidine;hydrochloride?
The canonical SMILES for 4-methoxy-3,3-dimethylpiperidine;hydrochloride is COC1CCNCC1(C)C.Cl.
What is the InChIKey of 4-methoxy-3,3-dimethylpiperidine;hydrochloride?
The InChIKey is JKLCZYXBGWNKMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO.ClH/c1-8(2)6-9-5-4-7(8)10-3;/h7,9H,4-6H2,1-3H3;1H.
What are the key properties of 4-methoxy-3,3-dimethylpiperidine;hydrochloride?
4-methoxy-3,3-dimethylpiperidine;hydrochloride has a molecular weight of 179.69 g/mol, XLogP of 1.44, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-3,3-dimethylpiperidine;hydrochloride is sourced from PubChem (CID 115015546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).