C10H16N2O — CID 115015683
2-(2-cyclopentyl-1,3-oxazol-4-yl)ethanamine (PubChem CID 115015683) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-(2-cyclopentyl-1,3-oxazol-4-yl)ethanamine.
| Compound Name | 2-(2-cyclopentyl-1,3-oxazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 115015683 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 2-(2-cyclopentyl-1,3-oxazol-4-yl)ethanamine |
| SMILES | NCCc1coc(C2CCCC2)n1 |
| InChI | InChI=1S/C10H16N2O/c11-6-5-9-7-13-10(12-9)8-3-1-2-4-8/h7-8H,1-6,11H2 |
| InChIKey | RIMZOBCDHUUPED-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |