About 3-(1-methylpiperidin-2-yl)-1,2-oxazol-5-amine
3-(1-methylpiperidin-2-yl)-1,2-oxazol-5-amine (PubChem CID 115015914) has the molecular formula C9H15N3O
and a molecular weight of 181.24 g/mol. Its IUPAC name is 3-(1-methylpiperidin-2-yl)-1,2-oxazol-5-amine.
Molecular Properties
| Compound Name | 3-(1-methylpiperidin-2-yl)-1,2-oxazol-5-amine |
| PubChem CID | 115015914 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 3-(1-methylpiperidin-2-yl)-1,2-oxazol-5-amine |
| SMILES | CN1CCCCC1c1cc(N)on1 |
| InChI | InChI=1S/C9H15N3O/c1-12-5-3-2-4-8(12)7-6-9(10)13-11-7/h6,8H,2-5,10H2,1H3 |
| InChIKey | GQDWFOJTWIGNLL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1-methylpiperidin-2-yl)-1,2-oxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-methylpiperidin-2-yl)-1,2-oxazol-5-amine?
The IUPAC name of 3-(1-methylpiperidin-2-yl)-1,2-oxazol-5-amine (CID 115015914) is 3-(1-methylpiperidin-2-yl)-1,2-oxazol-5-amine.
What is the SMILES notation for 3-(1-methylpiperidin-2-yl)-1,2-oxazol-5-amine?
The canonical SMILES for 3-(1-methylpiperidin-2-yl)-1,2-oxazol-5-amine is CN1CCCCC1c1cc(N)on1.
What is the InChIKey of 3-(1-methylpiperidin-2-yl)-1,2-oxazol-5-amine?
The InChIKey is GQDWFOJTWIGNLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O/c1-12-5-3-2-4-8(12)7-6-9(10)13-11-7/h6,8H,2-5,10H2,1H3.
What are the key properties of 3-(1-methylpiperidin-2-yl)-1,2-oxazol-5-amine?
3-(1-methylpiperidin-2-yl)-1,2-oxazol-5-amine has a molecular weight of 181.24 g/mol, XLogP of 1.41, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-methylpiperidin-2-yl)-1,2-oxazol-5-amine is sourced from PubChem (CID 115015914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).