C7H12N4S — CID 115016759
5-(thian-4-yl)-1H-1,2,4-triazol-3-amine (PubChem CID 115016759) has the molecular formula C7H12N4S and a molecular weight of 184.27 g/mol. Its IUPAC name is 5-(thian-4-yl)-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-(thian-4-yl)-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 115016759 |
| Molecular Formula | C7H12N4S |
| Molecular Weight | 184.27 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 5-(thian-4-yl)-1H-1,2,4-triazol-3-amine |
| SMILES | Nc1n[nH]c(C2CCSCC2)n1 |
| InChI | InChI=1S/C7H12N4S/c8-7-9-6(10-11-7)5-1-3-12-4-2-5/h5H,1-4H2,(H3,8,9,10,11) |
| InChIKey | NOGFKBIMKUXILV-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |