About tetrazolo[1,5-a]quinolin-9-ol
tetrazolo[1,5-a]quinolin-9-ol (PubChem CID 115017034) has the molecular formula C9H6N4O
and a molecular weight of 186.17 g/mol. Its IUPAC name is tetrazolo[1,5-a]quinolin-9-ol.
Molecular Properties
| Compound Name | tetrazolo[1,5-a]quinolin-9-ol |
| PubChem CID | 115017034 |
| Molecular Formula | C9H6N4O |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | tetrazolo[1,5-a]quinolin-9-ol |
| SMILES | Oc1cccc2ccc3nnnn3c12 |
| InChI | InChI=1S/C9H6N4O/c14-7-3-1-2-6-4-5-8-10-11-12-13(8)9(6)7/h1-5,14H |
| InChIKey | ZKWLZMIZAHQXMU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 63.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tetrazolo[1,5-a]quinolin-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrazolo[1,5-a]quinolin-9-ol?
The IUPAC name of tetrazolo[1,5-a]quinolin-9-ol (CID 115017034) is tetrazolo[1,5-a]quinolin-9-ol.
What is the SMILES notation for tetrazolo[1,5-a]quinolin-9-ol?
The canonical SMILES for tetrazolo[1,5-a]quinolin-9-ol is Oc1cccc2ccc3nnnn3c12.
What is the InChIKey of tetrazolo[1,5-a]quinolin-9-ol?
The InChIKey is ZKWLZMIZAHQXMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N4O/c14-7-3-1-2-6-4-5-8-10-11-12-13(8)9(6)7/h1-5,14H.
What are the key properties of tetrazolo[1,5-a]quinolin-9-ol?
tetrazolo[1,5-a]quinolin-9-ol has a molecular weight of 186.17 g/mol, XLogP of 0.98, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tetrazolo[1,5-a]quinolin-9-ol is sourced from PubChem (CID 115017034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).