About 2-isocyanato-2,4-dimethyl-1,3-dihydroindene
2-isocyanato-2,4-dimethyl-1,3-dihydroindene (PubChem CID 115017299) has the molecular formula C12H13NO
and a molecular weight of 187.24 g/mol. Its IUPAC name is 2-isocyanato-2,4-dimethyl-1,3-dihydroindene.
Molecular Properties
| Compound Name | 2-isocyanato-2,4-dimethyl-1,3-dihydroindene |
| PubChem CID | 115017299 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 2-isocyanato-2,4-dimethyl-1,3-dihydroindene |
| SMILES | Cc1cccc2c1CC(C)(N=C=O)C2 |
| InChI | InChI=1S/C12H13NO/c1-9-4-3-5-10-6-12(2,13-8-14)7-11(9)10/h3-5H,6-7H2,1-2H3 |
| InChIKey | YZNXEBLZHQBZLH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-isocyanato-2,4-dimethyl-1,3-dihydroindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isocyanato-2,4-dimethyl-1,3-dihydroindene?
The IUPAC name of 2-isocyanato-2,4-dimethyl-1,3-dihydroindene (CID 115017299) is 2-isocyanato-2,4-dimethyl-1,3-dihydroindene.
What is the SMILES notation for 2-isocyanato-2,4-dimethyl-1,3-dihydroindene?
The canonical SMILES for 2-isocyanato-2,4-dimethyl-1,3-dihydroindene is Cc1cccc2c1CC(C)(N=C=O)C2.
What is the InChIKey of 2-isocyanato-2,4-dimethyl-1,3-dihydroindene?
The InChIKey is YZNXEBLZHQBZLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO/c1-9-4-3-5-10-6-12(2,13-8-14)7-11(9)10/h3-5H,6-7H2,1-2H3.
What are the key properties of 2-isocyanato-2,4-dimethyl-1,3-dihydroindene?
2-isocyanato-2,4-dimethyl-1,3-dihydroindene has a molecular weight of 187.24 g/mol, XLogP of 2.19, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isocyanato-2,4-dimethyl-1,3-dihydroindene is sourced from PubChem (CID 115017299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).