About 8-methylspiro[1,3-dihydroquinazoline-4,1'-cyclopropane]-2-one
8-methylspiro[1,3-dihydroquinazoline-4,1'-cyclopropane]-2-one (PubChem CID 115017507) has the molecular formula C11H12N2O
and a molecular weight of 188.23 g/mol. Its IUPAC name is 8-methylspiro[1,3-dihydroquinazoline-4,1'-cyclopropane]-2-one.
Molecular Properties
| Compound Name | 8-methylspiro[1,3-dihydroquinazoline-4,1'-cyclopropane]-2-one |
| PubChem CID | 115017507 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 8-methylspiro[1,3-dihydroquinazoline-4,1'-cyclopropane]-2-one |
| SMILES | Cc1cccc2c1NC(=O)NC21CC1 |
| InChI | InChI=1S/C11H12N2O/c1-7-3-2-4-8-9(7)12-10(14)13-11(8)5-6-11/h2-4H,5-6H2,1H3,(H2,12,13,14) |
| InChIKey | NEWGJHOBNBRRIM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-methylspiro[1,3-dihydroquinazoline-4,1'-cyclopropane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methylspiro[1,3-dihydroquinazoline-4,1'-cyclopropane]-2-one?
The IUPAC name of 8-methylspiro[1,3-dihydroquinazoline-4,1'-cyclopropane]-2-one (CID 115017507) is 8-methylspiro[1,3-dihydroquinazoline-4,1'-cyclopropane]-2-one.
What is the SMILES notation for 8-methylspiro[1,3-dihydroquinazoline-4,1'-cyclopropane]-2-one?
The canonical SMILES for 8-methylspiro[1,3-dihydroquinazoline-4,1'-cyclopropane]-2-one is Cc1cccc2c1NC(=O)NC21CC1.
What is the InChIKey of 8-methylspiro[1,3-dihydroquinazoline-4,1'-cyclopropane]-2-one?
The InChIKey is NEWGJHOBNBRRIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O/c1-7-3-2-4-8-9(7)12-10(14)13-11(8)5-6-11/h2-4H,5-6H2,1H3,(H2,12,13,14).
What are the key properties of 8-methylspiro[1,3-dihydroquinazoline-4,1'-cyclopropane]-2-one?
8-methylspiro[1,3-dihydroquinazoline-4,1'-cyclopropane]-2-one has a molecular weight of 188.23 g/mol, XLogP of 2.12, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methylspiro[1,3-dihydroquinazoline-4,1'-cyclopropane]-2-one is sourced from PubChem (CID 115017507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).