About 1-azaspiro[5.5]undecane;hydrochloride
1-azaspiro[5.5]undecane;hydrochloride (PubChem CID 115017989) has the molecular formula C10H20ClN
and a molecular weight of 189.73 g/mol. Its IUPAC name is 1-azaspiro[5.5]undecane;hydrochloride.
Molecular Properties
| Compound Name | 1-azaspiro[5.5]undecane;hydrochloride |
| PubChem CID | 115017989 |
| Molecular Formula | C10H20ClN |
| Molecular Weight | 189.73 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 1-azaspiro[5.5]undecane;hydrochloride |
| SMILES | C1CCC2(CC1)CCCCN2.Cl |
| InChI | InChI=1S/C10H19N.ClH/c1-2-6-10(7-3-1)8-4-5-9-11-10;/h11H,1-9H2;1H |
| InChIKey | BOJMZFQFFDAJRW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.73 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-azaspiro[5.5]undecane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azaspiro[5.5]undecane;hydrochloride?
The IUPAC name of 1-azaspiro[5.5]undecane;hydrochloride (CID 115017989) is 1-azaspiro[5.5]undecane;hydrochloride.
What is the SMILES notation for 1-azaspiro[5.5]undecane;hydrochloride?
The canonical SMILES for 1-azaspiro[5.5]undecane;hydrochloride is C1CCC2(CC1)CCCCN2.Cl.
What is the InChIKey of 1-azaspiro[5.5]undecane;hydrochloride?
The InChIKey is BOJMZFQFFDAJRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N.ClH/c1-2-6-10(7-3-1)8-4-5-9-11-10;/h11H,1-9H2;1H.
What are the key properties of 1-azaspiro[5.5]undecane;hydrochloride?
1-azaspiro[5.5]undecane;hydrochloride has a molecular weight of 189.73 g/mol, XLogP of 2.88, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azaspiro[5.5]undecane;hydrochloride is sourced from PubChem (CID 115017989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).