C11H14N2O — CID 115018233
4-(2,3,4,5-tetrahydropyridin-6-ylamino)phenol (PubChem CID 115018233) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 4-(2,3,4,5-tetrahydropyridin-6-ylamino)phenol.
| Compound Name | 4-(2,3,4,5-tetrahydropyridin-6-ylamino)phenol |
|---|---|
| PubChem CID | 115018233 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 4-(2,3,4,5-tetrahydropyridin-6-ylamino)phenol |
| SMILES | Oc1ccc(NC2=NCCCC2)cc1 |
| InChI | InChI=1S/C11H14N2O/c14-10-6-4-9(5-7-10)13-11-3-1-2-8-12-11/h4-7,14H,1-3,8H2,(H,12,13) |
| InChIKey | GJFPGZWDSQVHPM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|