About (3S)-3-[(3R)-4,4-dimethyl-5-tri(propan-2-yl)silyloxypent-1-en-3-yl]oxyhex-5-enal
(3S)-3-[(3R)-4,4-dimethyl-5-tri(propan-2-yl)silyloxypent-1-en-3-yl]oxyhex-5-enal (PubChem CID 11501836) has the molecular formula C22H42O3Si
and a molecular weight of 382.66 g/mol. Its IUPAC name is (3S)-3-[(3R)-4,4-dimethyl-5-tri(propan-2-yl)silyloxypent-1-en-3-yl]oxyhex-5-enal.
Molecular Properties
| Compound Name | (3S)-3-[(3R)-4,4-dimethyl-5-tri(propan-2-yl)silyloxypent-1-en-3-yl]oxyhex-5-enal |
| PubChem CID | 11501836 |
| Molecular Formula | C22H42O3Si |
| Molecular Weight | 382.66 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | (3S)-3-[(3R)-4,4-dimethyl-5-tri(propan-2-yl)silyloxypent-1-en-3-yl]oxyhex-5-enal |
| SMILES | C=CC[C@@H](CC=O)O[C@H](C=C)C(C)(C)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H42O3Si/c1-11-13-20(14-15-23)25-21(12-2)22(9,10)16-24-26(17(3)4,18(5)6)19(7)8/h11-12,15,17-21H,1-2,13-14,16H2,3-10H3/t20-,21+/m0/s1 |
| InChIKey | DAXDLILEUJTDTB-LEWJYISDSA-N |
| XLogP | 6.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.66 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-[(3R)-4,4-dimethyl-5-tri(propan-2-yl)silyloxypent-1-en-3-yl]oxyhex-5-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[(3R)-4,4-dimethyl-5-tri(propan-2-yl)silyloxypent-1-en-3-yl]oxyhex-5-enal?
The IUPAC name of (3S)-3-[(3R)-4,4-dimethyl-5-tri(propan-2-yl)silyloxypent-1-en-3-yl]oxyhex-5-enal (CID 11501836) is (3S)-3-[(3R)-4,4-dimethyl-5-tri(propan-2-yl)silyloxypent-1-en-3-yl]oxyhex-5-enal.
What is the SMILES notation for (3S)-3-[(3R)-4,4-dimethyl-5-tri(propan-2-yl)silyloxypent-1-en-3-yl]oxyhex-5-enal?
The canonical SMILES for (3S)-3-[(3R)-4,4-dimethyl-5-tri(propan-2-yl)silyloxypent-1-en-3-yl]oxyhex-5-enal is C=CC[C@@H](CC=O)O[C@H](C=C)C(C)(C)CO[Si](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of (3S)-3-[(3R)-4,4-dimethyl-5-tri(propan-2-yl)silyloxypent-1-en-3-yl]oxyhex-5-enal?
The InChIKey is DAXDLILEUJTDTB-LEWJYISDSA-N. The full InChI is InChI=1S/C22H42O3Si/c1-11-13-20(14-15-23)25-21(12-2)22(9,10)16-24-26(17(3)4,18(5)6)19(7)8/h11-12,15,17-21H,1-2,13-14,16H2,3-10H3/t20-,21+/m0/s1.
What are the key properties of (3S)-3-[(3R)-4,4-dimethyl-5-tri(propan-2-yl)silyloxypent-1-en-3-yl]oxyhex-5-enal?
(3S)-3-[(3R)-4,4-dimethyl-5-tri(propan-2-yl)silyloxypent-1-en-3-yl]oxyhex-5-enal has a molecular weight of 382.66 g/mol, XLogP of 6.31, 14 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[(3R)-4,4-dimethyl-5-tri(propan-2-yl)silyloxypent-1-en-3-yl]oxyhex-5-enal is sourced from PubChem (CID 11501836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).