About [2-fluoro-5-(1,3-oxazol-4-yl)phenyl]methanamine
[2-fluoro-5-(1,3-oxazol-4-yl)phenyl]methanamine (PubChem CID 115018907) has the molecular formula C10H9FN2O
and a molecular weight of 192.19 g/mol. Its IUPAC name is [2-fluoro-5-(1,3-oxazol-4-yl)phenyl]methanamine.
Molecular Properties
| Compound Name | [2-fluoro-5-(1,3-oxazol-4-yl)phenyl]methanamine |
| PubChem CID | 115018907 |
| Molecular Formula | C10H9FN2O |
| Molecular Weight | 192.19 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | [2-fluoro-5-(1,3-oxazol-4-yl)phenyl]methanamine |
| SMILES | NCc1cc(-c2cocn2)ccc1F |
| InChI | InChI=1S/C10H9FN2O/c11-9-2-1-7(3-8(9)4-12)10-5-14-6-13-10/h1-3,5-6H,4,12H2 |
| InChIKey | BYCYDJPSFQUNCW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.19 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-fluoro-5-(1,3-oxazol-4-yl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-fluoro-5-(1,3-oxazol-4-yl)phenyl]methanamine?
The IUPAC name of [2-fluoro-5-(1,3-oxazol-4-yl)phenyl]methanamine (CID 115018907) is [2-fluoro-5-(1,3-oxazol-4-yl)phenyl]methanamine.
What is the SMILES notation for [2-fluoro-5-(1,3-oxazol-4-yl)phenyl]methanamine?
The canonical SMILES for [2-fluoro-5-(1,3-oxazol-4-yl)phenyl]methanamine is NCc1cc(-c2cocn2)ccc1F.
What is the InChIKey of [2-fluoro-5-(1,3-oxazol-4-yl)phenyl]methanamine?
The InChIKey is BYCYDJPSFQUNCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FN2O/c11-9-2-1-7(3-8(9)4-12)10-5-14-6-13-10/h1-3,5-6H,4,12H2.
What are the key properties of [2-fluoro-5-(1,3-oxazol-4-yl)phenyl]methanamine?
[2-fluoro-5-(1,3-oxazol-4-yl)phenyl]methanamine has a molecular weight of 192.19 g/mol, XLogP of 1.94, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-fluoro-5-(1,3-oxazol-4-yl)phenyl]methanamine is sourced from PubChem (CID 115018907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).