C10H12N2O2 — CID 115018957
2-(2-hydroxyethyl)-3-methylimidazo[1,2-a]pyridin-6-ol (PubChem CID 115018957) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 2-(2-hydroxyethyl)-3-methylimidazo[1,2-a]pyridin-6-ol.
| Compound Name | 2-(2-hydroxyethyl)-3-methylimidazo[1,2-a]pyridin-6-ol |
|---|---|
| PubChem CID | 115018957 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 2-(2-hydroxyethyl)-3-methylimidazo[1,2-a]pyridin-6-ol |
| SMILES | Cc1c(CCO)nc2ccc(O)cn12 |
| InChI | InChI=1S/C10H12N2O2/c1-7-9(4-5-13)11-10-3-2-8(14)6-12(7)10/h2-3,6,13-14H,4-5H2,1H3 |
| InChIKey | JIPSKFWKNZVUPY-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 57.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |