C23H23N5O — CID 11501900
7-cyclopentyl-5-(3-phenylmethoxyphenyl)imidazo[5,1-f][1,2,4]triazin-4-amine (PubChem CID 11501900) has the molecular formula C23H23N5O and a molecular weight of 385.47 g/mol. Its IUPAC name is 7-cyclopentyl-5-(3-phenylmethoxyphenyl)imidazo[5,1-f][1,2,4]triazin-4-amine.
| Compound Name | 7-cyclopentyl-5-(3-phenylmethoxyphenyl)imidazo[5,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 11501900 |
| Molecular Formula | C23H23N5O |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 7-cyclopentyl-5-(3-phenylmethoxyphenyl)imidazo[5,1-f][1,2,4]triazin-4-amine |
| SMILES | Nc1ncnn2c(C3CCCC3)nc(-c3cccc(OCc4ccccc4)c3)c12 |
| InChI | InChI=1S/C23H23N5O/c24-22-21-20(27-23(17-9-4-5-10-17)28(21)26-15-25-22)18-11-6-12-19(13-18)29-14-16-7-2-1-3-8-16/h1-3,6-8,11-13,15,17H,4-5,9-10,14H2,(H2,24,25,26) |
| InChIKey | TYCIWDMGYSEZFE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |