(2Z,4E)-5-(1-methylpiperidin-3-yl)penta-2,4-dienoic acid

C11H17NO2 — CID 115020259

IUPAC(2Z,4E)-5-(1-methylpiperidin-3-yl)penta-2,4-dienoic acid
SMILESCN1CCCC(/C=C/C=C\C(=O)O)C1
InChIInChI=1S/C11H17NO2/c1-12-8-4-6-10(9-12)5-2-3-7-11(13)14/h2-3,5,7,10H,4,6,8-9H2,1H3,(H,13,14)/b5-2+,7-3-
InChIKeyILCTUMJKSDIGLH-BUSGPAIPSA-N
MW195.26 g/mol
LogP1.53
Rot. Bonds3

About (2Z,4E)-5-(1-methylpiperidin-3-yl)penta-2,4-dienoic acid

(2Z,4E)-5-(1-methylpiperidin-3-yl)penta-2,4-dienoic acid (PubChem CID 115020259) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is (2Z,4E)-5-(1-methylpiperidin-3-yl)penta-2,4-dienoic acid.

Molecular Properties

Compound Name(2Z,4E)-5-(1-methylpiperidin-3-yl)penta-2,4-dienoic acid
PubChem CID115020259
Molecular FormulaC11H17NO2
Molecular Weight195.26 g/mol
Exact Mass195.13
IUPAC Name(2Z,4E)-5-(1-methylpiperidin-3-yl)penta-2,4-dienoic acid
SMILESCN1CCCC(/C=C/C=C\C(=O)O)C1
InChIInChI=1S/C11H17NO2/c1-12-8-4-6-10(9-12)5-2-3-7-11(13)14/h2-3,5,7,10H,4,6,8-9H2,1H3,(H,13,14)/b5-2+,7-3-
InChIKeyILCTUMJKSDIGLH-BUSGPAIPSA-N
XLogP1.53
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.26
LogP ≤ 51.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (2Z,4E)-5-(1-methylpiperidin-3-yl)penta-2,4-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2Z,4E)-5-(1-methylpiperidin-3-yl)penta-2,4-dienoic acid?
The IUPAC name of (2Z,4E)-5-(1-methylpiperidin-3-yl)penta-2,4-dienoic acid (CID 115020259) is (2Z,4E)-5-(1-methylpiperidin-3-yl)penta-2,4-dienoic acid.
What is the SMILES notation for (2Z,4E)-5-(1-methylpiperidin-3-yl)penta-2,4-dienoic acid?
The canonical SMILES for (2Z,4E)-5-(1-methylpiperidin-3-yl)penta-2,4-dienoic acid is CN1CCCC(/C=C/C=C\C(=O)O)C1.
What is the InChIKey of (2Z,4E)-5-(1-methylpiperidin-3-yl)penta-2,4-dienoic acid?
The InChIKey is ILCTUMJKSDIGLH-BUSGPAIPSA-N. The full InChI is InChI=1S/C11H17NO2/c1-12-8-4-6-10(9-12)5-2-3-7-11(13)14/h2-3,5,7,10H,4,6,8-9H2,1H3,(H,13,14)/b5-2+,7-3-.
What are the key properties of (2Z,4E)-5-(1-methylpiperidin-3-yl)penta-2,4-dienoic acid?
(2Z,4E)-5-(1-methylpiperidin-3-yl)penta-2,4-dienoic acid has a molecular weight of 195.26 g/mol, XLogP of 1.53, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4E)-5-(1-methylpiperidin-3-yl)penta-2,4-dienoic acid is sourced from PubChem (CID 115020259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).