C11H17NO2 — CID 115020259
(2Z,4E)-5-(1-methylpiperidin-3-yl)penta-2,4-dienoic acid (PubChem CID 115020259) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is (2Z,4E)-5-(1-methylpiperidin-3-yl)penta-2,4-dienoic acid.
| Compound Name | (2Z,4E)-5-(1-methylpiperidin-3-yl)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 115020259 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | (2Z,4E)-5-(1-methylpiperidin-3-yl)penta-2,4-dienoic acid |
| SMILES | CN1CCCC(/C=C/C=C\C(=O)O)C1 |
| InChI | InChI=1S/C11H17NO2/c1-12-8-4-6-10(9-12)5-2-3-7-11(13)14/h2-3,5,7,10H,4,6,8-9H2,1H3,(H,13,14)/b5-2+,7-3- |
| InChIKey | ILCTUMJKSDIGLH-BUSGPAIPSA-N |
| XLogP | 1.53 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|