About 2-(2,3-dibromo-4,5-dihydroxyphenyl)ethyl hydrogen sulfate
2-(2,3-dibromo-4,5-dihydroxyphenyl)ethyl hydrogen sulfate (PubChem CID 11502039) has the molecular formula C8H8Br2O6S
and a molecular weight of 392.02 g/mol. Its IUPAC name is 2-(2,3-dibromo-4,5-dihydroxyphenyl)ethyl hydrogen sulfate.
Molecular Properties
| Compound Name | 2-(2,3-dibromo-4,5-dihydroxyphenyl)ethyl hydrogen sulfate |
| PubChem CID | 11502039 |
| Molecular Formula | C8H8Br2O6S |
| Molecular Weight | 392.02 g/mol |
| Exact Mass | 389.84 |
| IUPAC Name | 2-(2,3-dibromo-4,5-dihydroxyphenyl)ethyl hydrogen sulfate |
| SMILES | O=S(=O)(O)OCCc1cc(O)c(O)c(Br)c1Br |
| InChI | InChI=1S/C8H8Br2O6S/c9-6-4(1-2-16-17(13,14)15)3-5(11)8(12)7(6)10/h3,11-12H,1-2H2,(H,13,14,15) |
| InChIKey | IVDRMONUQOVGSF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.02 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3-dibromo-4,5-dihydroxyphenyl)ethyl hydrogen sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dibromo-4,5-dihydroxyphenyl)ethyl hydrogen sulfate?
The IUPAC name of 2-(2,3-dibromo-4,5-dihydroxyphenyl)ethyl hydrogen sulfate (CID 11502039) is 2-(2,3-dibromo-4,5-dihydroxyphenyl)ethyl hydrogen sulfate.
What is the SMILES notation for 2-(2,3-dibromo-4,5-dihydroxyphenyl)ethyl hydrogen sulfate?
The canonical SMILES for 2-(2,3-dibromo-4,5-dihydroxyphenyl)ethyl hydrogen sulfate is O=S(=O)(O)OCCc1cc(O)c(O)c(Br)c1Br.
What is the InChIKey of 2-(2,3-dibromo-4,5-dihydroxyphenyl)ethyl hydrogen sulfate?
The InChIKey is IVDRMONUQOVGSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Br2O6S/c9-6-4(1-2-16-17(13,14)15)3-5(11)8(12)7(6)10/h3,11-12H,1-2H2,(H,13,14,15).
What are the key properties of 2-(2,3-dibromo-4,5-dihydroxyphenyl)ethyl hydrogen sulfate?
2-(2,3-dibromo-4,5-dihydroxyphenyl)ethyl hydrogen sulfate has a molecular weight of 392.02 g/mol, XLogP of 1.98, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dibromo-4,5-dihydroxyphenyl)ethyl hydrogen sulfate is sourced from PubChem (CID 11502039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).