C8H12N4O2 — CID 115020586
4-hydroxy-5-piperazin-1-yl-1H-pyrimidin-6-one (PubChem CID 115020586) has the molecular formula C8H12N4O2 and a molecular weight of 196.21 g/mol. Its IUPAC name is 4-hydroxy-5-piperazin-1-yl-1H-pyrimidin-6-one.
| Compound Name | 4-hydroxy-5-piperazin-1-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 115020586 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 4-hydroxy-5-piperazin-1-yl-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(O)c1N1CCNCC1 |
| InChI | InChI=1S/C8H12N4O2/c13-7-6(8(14)11-5-10-7)12-3-1-9-2-4-12/h5,9H,1-4H2,(H2,10,11,13,14) |
| InChIKey | RFZOPEDVQHVMSH-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |