About [5-(4-methyloxan-4-yl)-1,3-oxazol-2-yl]methanamine
[5-(4-methyloxan-4-yl)-1,3-oxazol-2-yl]methanamine (PubChem CID 115020665) has the molecular formula C10H16N2O2
and a molecular weight of 196.25 g/mol. Its IUPAC name is [5-(4-methyloxan-4-yl)-1,3-oxazol-2-yl]methanamine.
Molecular Properties
| Compound Name | [5-(4-methyloxan-4-yl)-1,3-oxazol-2-yl]methanamine |
| PubChem CID | 115020665 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | [5-(4-methyloxan-4-yl)-1,3-oxazol-2-yl]methanamine |
| SMILES | CC1(c2cnc(CN)o2)CCOCC1 |
| InChI | InChI=1S/C10H16N2O2/c1-10(2-4-13-5-3-10)8-7-12-9(6-11)14-8/h7H,2-6,11H2,1H3 |
| InChIKey | QFGFCOOWUYEDFB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(4-methyloxan-4-yl)-1,3-oxazol-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4-methyloxan-4-yl)-1,3-oxazol-2-yl]methanamine?
The IUPAC name of [5-(4-methyloxan-4-yl)-1,3-oxazol-2-yl]methanamine (CID 115020665) is [5-(4-methyloxan-4-yl)-1,3-oxazol-2-yl]methanamine.
What is the SMILES notation for [5-(4-methyloxan-4-yl)-1,3-oxazol-2-yl]methanamine?
The canonical SMILES for [5-(4-methyloxan-4-yl)-1,3-oxazol-2-yl]methanamine is CC1(c2cnc(CN)o2)CCOCC1.
What is the InChIKey of [5-(4-methyloxan-4-yl)-1,3-oxazol-2-yl]methanamine?
The InChIKey is QFGFCOOWUYEDFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2/c1-10(2-4-13-5-3-10)8-7-12-9(6-11)14-8/h7H,2-6,11H2,1H3.
What are the key properties of [5-(4-methyloxan-4-yl)-1,3-oxazol-2-yl]methanamine?
[5-(4-methyloxan-4-yl)-1,3-oxazol-2-yl]methanamine has a molecular weight of 196.25 g/mol, XLogP of 1.20, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-methyloxan-4-yl)-1,3-oxazol-2-yl]methanamine is sourced from PubChem (CID 115020665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).