2-cyclopropyl-2-methylpropane-1-sulfonyl chloride

C7H13ClO2S — CID 115020909

IUPAC2-cyclopropyl-2-methylpropane-1-sulfonyl chloride
SMILESCC(C)(CS(=O)(=O)Cl)C1CC1
InChIInChI=1S/C7H13ClO2S/c1-7(2,6-3-4-6)5-11(8,9)10/h6H,3-5H2,1-2H3
InChIKeyHDEZCLXLHJQACX-UHFFFAOYSA-N
MW196.70 g/mol
LogP1.99
Rot. Bonds3

About 2-cyclopropyl-2-methylpropane-1-sulfonyl chloride

2-cyclopropyl-2-methylpropane-1-sulfonyl chloride (PubChem CID 115020909) has the molecular formula C7H13ClO2S and a molecular weight of 196.70 g/mol. Its IUPAC name is 2-cyclopropyl-2-methylpropane-1-sulfonyl chloride.

Molecular Properties

Compound Name2-cyclopropyl-2-methylpropane-1-sulfonyl chloride
PubChem CID115020909
Molecular FormulaC7H13ClO2S
Molecular Weight196.70 g/mol
Exact Mass196.03
IUPAC Name2-cyclopropyl-2-methylpropane-1-sulfonyl chloride
SMILESCC(C)(CS(=O)(=O)Cl)C1CC1
InChIInChI=1S/C7H13ClO2S/c1-7(2,6-3-4-6)5-11(8,9)10/h6H,3-5H2,1-2H3
InChIKeyHDEZCLXLHJQACX-UHFFFAOYSA-N
XLogP1.99
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.70
LogP ≤ 51.99
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 2-cyclopropyl-2-methylpropane-1-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-cyclopropyl-2-methylpropane-1-sulfonyl chloride?
The IUPAC name of 2-cyclopropyl-2-methylpropane-1-sulfonyl chloride (CID 115020909) is 2-cyclopropyl-2-methylpropane-1-sulfonyl chloride.
What is the SMILES notation for 2-cyclopropyl-2-methylpropane-1-sulfonyl chloride?
The canonical SMILES for 2-cyclopropyl-2-methylpropane-1-sulfonyl chloride is CC(C)(CS(=O)(=O)Cl)C1CC1.
What is the InChIKey of 2-cyclopropyl-2-methylpropane-1-sulfonyl chloride?
The InChIKey is HDEZCLXLHJQACX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13ClO2S/c1-7(2,6-3-4-6)5-11(8,9)10/h6H,3-5H2,1-2H3.
What are the key properties of 2-cyclopropyl-2-methylpropane-1-sulfonyl chloride?
2-cyclopropyl-2-methylpropane-1-sulfonyl chloride has a molecular weight of 196.70 g/mol, XLogP of 1.99, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-2-methylpropane-1-sulfonyl chloride is sourced from PubChem (CID 115020909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).