2-[5-(oxolan-3-yl)-1,3,4-oxadiazol-2-yl]acetic acid

C8H10N2O4 — CID 115021308

IUPAC2-[5-(oxolan-3-yl)-1,3,4-oxadiazol-2-yl]acetic acid
SMILESO=C(O)Cc1nnc(C2CCOC2)o1
InChIInChI=1S/C8H10N2O4/c11-7(12)3-6-9-10-8(14-6)5-1-2-13-4-5/h5H,1-4H2,(H,11,12)
InChIKeyVQZIKJIXYVCQJA-UHFFFAOYSA-N
MW198.18 g/mol
LogP0.20
Rot. Bonds3

About 2-[5-(oxolan-3-yl)-1,3,4-oxadiazol-2-yl]acetic acid

2-[5-(oxolan-3-yl)-1,3,4-oxadiazol-2-yl]acetic acid (PubChem CID 115021308) has the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. Its IUPAC name is 2-[5-(oxolan-3-yl)-1,3,4-oxadiazol-2-yl]acetic acid.

Molecular Properties

Compound Name2-[5-(oxolan-3-yl)-1,3,4-oxadiazol-2-yl]acetic acid
PubChem CID115021308
Molecular FormulaC8H10N2O4
Molecular Weight198.18 g/mol
Exact Mass198.06
IUPAC Name2-[5-(oxolan-3-yl)-1,3,4-oxadiazol-2-yl]acetic acid
SMILESO=C(O)Cc1nnc(C2CCOC2)o1
InChIInChI=1S/C8H10N2O4/c11-7(12)3-6-9-10-8(14-6)5-1-2-13-4-5/h5H,1-4H2,(H,11,12)
InChIKeyVQZIKJIXYVCQJA-UHFFFAOYSA-N
XLogP0.20
TPSA85.45 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.18
LogP ≤ 50.20
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[5-(oxolan-3-yl)-1,3,4-oxadiazol-2-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[5-(oxolan-3-yl)-1,3,4-oxadiazol-2-yl]acetic acid?
The IUPAC name of 2-[5-(oxolan-3-yl)-1,3,4-oxadiazol-2-yl]acetic acid (CID 115021308) is 2-[5-(oxolan-3-yl)-1,3,4-oxadiazol-2-yl]acetic acid.
What is the SMILES notation for 2-[5-(oxolan-3-yl)-1,3,4-oxadiazol-2-yl]acetic acid?
The canonical SMILES for 2-[5-(oxolan-3-yl)-1,3,4-oxadiazol-2-yl]acetic acid is O=C(O)Cc1nnc(C2CCOC2)o1.
What is the InChIKey of 2-[5-(oxolan-3-yl)-1,3,4-oxadiazol-2-yl]acetic acid?
The InChIKey is VQZIKJIXYVCQJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O4/c11-7(12)3-6-9-10-8(14-6)5-1-2-13-4-5/h5H,1-4H2,(H,11,12).
What are the key properties of 2-[5-(oxolan-3-yl)-1,3,4-oxadiazol-2-yl]acetic acid?
2-[5-(oxolan-3-yl)-1,3,4-oxadiazol-2-yl]acetic acid has a molecular weight of 198.18 g/mol, XLogP of 0.20, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(oxolan-3-yl)-1,3,4-oxadiazol-2-yl]acetic acid is sourced from PubChem (CID 115021308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).